6,7-difluoro-1-methyl-4-oxo-1H,4H-[1,3]thiazeto[3,2-a]quinoline-3-carboxylic acid, ethyl ester - Names and Identifiers
Name | Ethyl 6,7-difluoro-1-methyl-4-oxo-4H-[1,3]thiazeto[3,2-a]quinoline-3-carboxylate
|
Synonyms | PL-9 PRULIFLOXACIN INTERMEDIATE 1 Ethyl6,7-difluoro-1-methyl-4-oxo-4H-[1,3]thiazeto[3,2-a]quinoline-3-carboxylate ETHYL 6,7-DIFLUORO-1-METHYL-4-OXO-4H-(1,3-)THIAZETO(3,2,-A)QUINOLINE-3-CARBOXYLA Ethyl 6,7-difluoro-1-methyl-4-oxo-4H-[1,3]thiazeto[3,2-a]quinoline-3-carboxylate ETHYL 6,7-DIFLUORO-1-METHYL-4-OXO-4H-[1,3]THIAZETO[3,2-A]QUINOLINE-3-CARBOXYLATE Ethyl 6,7-Difluoro-1-Methyl-4-Oxo-1H,4H-(1,3)Thiazeto(3,2-a)Quinoline-3-Carboxylate 6,7-DIFLUORO-1-METHYL-4-OXO-4H-(1,3)THIAZETO(3,2-A)QUINOLINE-3-CARBOYLIC ACID ETHYL ESTER 6,7-DIFLUORO-1-METHYL-4-OXO-4H-[1,3]THIAZETO[3,2-A]-3-QUINOLINE CARBOXYLIC ACID ETHYL ESTER Ethyl 6,7-Difluoro-1-Methyl-4-Oxo-4H-(1,3) Thiazeto(3,2-A) Quinoline-3-Carboxylate123447-62-1 6,7-difluoro-1-methyl-4-oxo-1H,4H-[1,3]thiazeto[3,2-a]quinoline-3-carboxylic acid, ethyl ester 6,7-DIFLUORO-1-METHYL-4-OXO-4H-2-THIA-8B-AZA-CYCLOBUTA[A]NAPHTHALENE-3-CARBOXYLIC ACID ETHYL ESTER
|
CAS | 113046-72-3
|
EINECS | 601-229-4 |
InChI | InChI=1/C14H11F2NO3S/c1-3-20-14(19)11-12(18)7-4-8(15)9(16)5-10(7)17-6(2)21-13(11)17/h4-6H,3H2,1-2H3 |
6,7-difluoro-1-methyl-4-oxo-1H,4H-[1,3]thiazeto[3,2-a]quinoline-3-carboxylic acid, ethyl ester - Physico-chemical Properties
Molecular Formula | C14H11F2NO3S
|
Molar Mass | 311.3 |
Density | 1.50±0.1 g/cm3(Predicted) |
Melting Point | 202 °C(Solv: chloroform (67-66-3); methanol (67-56-1)) |
Boling Point | 436.8±45.0 °C(Predicted) |
Flash Point | 218°C |
Vapor Presure | 7.87E-08mmHg at 25°C |
pKa | -6.29±0.60(Predicted) |
Storage Condition | Sealed in dry,Room Temperature |
Refractive Index | 1.625 |
6,7-difluoro-1-methyl-4-oxo-1H,4H-[1,3]thiazeto[3,2-a]quinoline-3-carboxylic acid, ethyl ester - Introduction
Ethyl 6,7-difluoro-1-methyl-4-oxo-4H-[1,3] thiazine [3,2-a] noquinoline-3-carboxylate, also known as Diacetoxyscirpenol, has the chemical formula C12H8F2N2O4S.
The compound has the following properties:
1. Appearance: This is a colorless crystalline solid.
2. melting point: about 135-140 degrees Celsius.
3. Solubility: Soluble in organic solvents such as ethanol, acetone and dimethyl sulfoxide, insoluble in water.
The compound is mainly used in the agricultural field, as a fungicide and toxicin, for the prevention and control of fungal infections on crops. It can effectively inhibit the growth and reproduction of plant pathogenic fungi.
A common method for preparing ethyl 6,7-difluoro-1-methyl-4-oxo-4H-[1,3] thiazine [3,2-a] quinoline-3-carboxylate is to react with thiazine and ethyl 2,3-difluorobenzoate to generate an intermediate, and then further react with methyl chloroformate to generate the target product. The specific preparation method requires certain knowledge of chemical synthesis and experimental skills.
When using and handling 6,7-difluoro-1-methyl-4-oxo-4H-[1,3] thiazine [3,2-a] quinoline-3-carboxylic acid ethyl ester, the following safety precautions should be taken:
1. Follow laboratory safety procedures and wear appropriate protective gloves, glasses and laboratory coats.
2. Avoid inhaling aerosols or dust and use protective masks.
3. avoid contact with skin, such as contact with skin, immediately rinse with plenty of water and soap.
4. Avoid contact when eating, drinking or smoking. Do not touch the mouth, eyes and face with your hands.
5. Keep the laboratory well ventilated to avoid harmful gas concentration exceeding the standard.
6. storage should be sealed, in a cool, dry, well-ventilated place, away from fire and oxidant.
Last Update:2024-04-10 22:29:15